C26H23NO4 — CID 7103627
dimethyl (2S,5S)-1,2,5-triphenyl-2,5-dihydropyrrole-3,4-dicarboxylate (PubChem CID 7103627) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is dimethyl (2S,5S)-1,2,5-triphenyl-2,5-dihydropyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl (2S,5S)-1,2,5-triphenyl-2,5-dihydropyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 7103627 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | dimethyl (2S,5S)-1,2,5-triphenyl-2,5-dihydropyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@H](c2ccccc2)N(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H23NO4/c1-30-25(28)21-22(26(29)31-2)24(19-14-8-4-9-15-19)27(20-16-10-5-11-17-20)23(21)18-12-6-3-7-13-18/h3-17,23-24H,1-2H3/t23-,24-/m0/s1 |
| InChIKey | POQQDNGGYUNLCD-ZEQRLZLVSA-N |
| XLogP | 4.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |