C20H19NO4 — CID 101203349
dimethyl (2R,5R)-2,5-diphenyl-2,5-dihydro-1H-pyrrole-3,4-dicarboxylate (PubChem CID 101203349) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is dimethyl (2R,5R)-2,5-diphenyl-2,5-dihydro-1H-pyrrole-3,4-dicarboxylate.
| Compound Name | dimethyl (2R,5R)-2,5-diphenyl-2,5-dihydro-1H-pyrrole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 101203349 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | dimethyl (2R,5R)-2,5-diphenyl-2,5-dihydro-1H-pyrrole-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H](c2ccccc2)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H19NO4/c1-24-19(22)15-16(20(23)25-2)18(14-11-7-4-8-12-14)21-17(15)13-9-5-3-6-10-13/h3-12,17-18,21H,1-2H3/t17-,18-/m1/s1 |
| InChIKey | BRIDODRQBCFYKU-QZTJIDSGSA-N |
| XLogP | 2.71 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |