C16H17N3O4 — CID 95738715
methyl (3S,8R)-3-methyl-1,6-dioxo-8-phenyl-3,4,7,8-tetrahydro-2H-pyrazino[1,2-c]pyrimidine-9-carboxylate (PubChem CID 95738715) has the molecular formula C16H17N3O4 and a molecular weight of 315.33 g/mol. Its IUPAC name is methyl (3S,8R)-3-methyl-1,6-dioxo-8-phenyl-3,4,7,8-tetrahydro-2H-pyrazino[1,2-c]pyrimidine-9-carboxylate.
| Compound Name | methyl (3S,8R)-3-methyl-1,6-dioxo-8-phenyl-3,4,7,8-tetrahydro-2H-pyrazino[1,2-c]pyrimidine-9-carboxylate |
|---|---|
| PubChem CID | 95738715 |
| Molecular Formula | C16H17N3O4 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | methyl (3S,8R)-3-methyl-1,6-dioxo-8-phenyl-3,4,7,8-tetrahydro-2H-pyrazino[1,2-c]pyrimidine-9-carboxylate |
| SMILES | COC(=O)C1=C2C(=O)N[C@@H](C)CN2C(=O)N[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H17N3O4/c1-9-8-19-13(14(20)17-9)11(15(21)23-2)12(18-16(19)22)10-6-4-3-5-7-10/h3-7,9,12H,8H2,1-2H3,(H,17,20)(H,18,22)/t9-,12+/m0/s1 |
| InChIKey | RWSCTWGDAJEWOA-JOYOIKCWSA-N |
| XLogP | 0.70 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |