methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate

C18H16N2O4 — CID 42868328

IUPACmethyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate
SMILESCOC(=O)c1ccccc1N1C(=O)CC(c2ccccc2)NC1=O
InChIInChI=1S/C18H16N2O4/c1-24-17(22)13-9-5-6-10-15(13)20-16(21)11-14(19-18(20)23)12-7-3-2-4-8-12/h2-10,14H,11H2,1H3,(H,19,23)
InChIKeyFBRKIZIXVIZPPN-UHFFFAOYSA-N
MW324.34 g/mol
LogP2.66
Rot. Bonds3

About methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate

methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate (PubChem CID 42868328) has the molecular formula C18H16N2O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate.

Molecular Properties

Compound Namemethyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate
PubChem CID42868328
Molecular FormulaC18H16N2O4
Molecular Weight324.34 g/mol
Exact Mass324.11
IUPAC Namemethyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate
SMILESCOC(=O)c1ccccc1N1C(=O)CC(c2ccccc2)NC1=O
InChIInChI=1S/C18H16N2O4/c1-24-17(22)13-9-5-6-10-15(13)20-16(21)11-14(19-18(20)23)12-7-3-2-4-8-12/h2-10,14H,11H2,1H3,(H,19,23)
InChIKeyFBRKIZIXVIZPPN-UHFFFAOYSA-N
XLogP2.66
TPSA75.71 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500324.34
LogP ≤ 52.66
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate?
The IUPAC name of methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate (CID 42868328) is methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate.
What is the SMILES notation for methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate?
The canonical SMILES for methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate is COC(=O)c1ccccc1N1C(=O)CC(c2ccccc2)NC1=O.
What is the InChIKey of methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate?
The InChIKey is FBRKIZIXVIZPPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O4/c1-24-17(22)13-9-5-6-10-15(13)20-16(21)11-14(19-18(20)23)12-7-3-2-4-8-12/h2-10,14H,11H2,1H3,(H,19,23).
What are the key properties of methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate?
methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate has a molecular weight of 324.34 g/mol, XLogP of 2.66, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,6-dioxo-4-phenyl-1,3-diazinan-1-yl)benzoate is sourced from PubChem (CID 42868328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).