C17H11FN2O5 — CID 11371270
methyl 2-[3-(4-fluorophenyl)-2,4,5-trioxoimidazolidin-1-yl]benzoate (PubChem CID 11371270) has the molecular formula C17H11FN2O5 and a molecular weight of 342.28 g/mol. Its IUPAC name is methyl 2-[3-(4-fluorophenyl)-2,4,5-trioxoimidazolidin-1-yl]benzoate.
| Compound Name | methyl 2-[3-(4-fluorophenyl)-2,4,5-trioxoimidazolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 11371270 |
| Molecular Formula | C17H11FN2O5 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | methyl 2-[3-(4-fluorophenyl)-2,4,5-trioxoimidazolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)C(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C17H11FN2O5/c1-25-16(23)12-4-2-3-5-13(12)20-15(22)14(21)19(17(20)24)11-8-6-10(18)7-9-11/h2-9H,1H3 |
| InChIKey | HTTUYVONVUIAGD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|