methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate

C15H11NO5S — CID 12888522

IUPACmethyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate
SMILESCOC(=O)c1ccccc1N1C(=O)c2ccccc2S1(=O)=O
InChIInChI=1S/C15H11NO5S/c1-21-15(18)10-6-2-4-8-12(10)16-14(17)11-7-3-5-9-13(11)22(16,19)20/h2-9H,1H3
InChIKeyTVFCYLYKRBBQHZ-UHFFFAOYSA-N
MW317.32 g/mol
LogP1.82
Rot. Bonds2

About methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate

methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate (PubChem CID 12888522) has the molecular formula C15H11NO5S and a molecular weight of 317.32 g/mol. Its IUPAC name is methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate.

Molecular Properties

Compound Namemethyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate
PubChem CID12888522
Molecular FormulaC15H11NO5S
Molecular Weight317.32 g/mol
Exact Mass317.04
IUPAC Namemethyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate
SMILESCOC(=O)c1ccccc1N1C(=O)c2ccccc2S1(=O)=O
InChIInChI=1S/C15H11NO5S/c1-21-15(18)10-6-2-4-8-12(10)16-14(17)11-7-3-5-9-13(11)22(16,19)20/h2-9H,1H3
InChIKeyTVFCYLYKRBBQHZ-UHFFFAOYSA-N
XLogP1.82
TPSA80.75 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500317.32
LogP ≤ 51.82
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate?
The IUPAC name of methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate (CID 12888522) is methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate.
What is the SMILES notation for methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate?
The canonical SMILES for methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate is COC(=O)c1ccccc1N1C(=O)c2ccccc2S1(=O)=O.
What is the InChIKey of methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate?
The InChIKey is TVFCYLYKRBBQHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO5S/c1-21-15(18)10-6-2-4-8-12(10)16-14(17)11-7-3-5-9-13(11)22(16,19)20/h2-9H,1H3.
What are the key properties of methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate?
methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate has a molecular weight of 317.32 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(1,1,3-trioxo-1,2-benzothiazol-2-yl)benzoate is sourced from PubChem (CID 12888522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).