About methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate
methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate (PubChem CID 23612158) has the molecular formula C19H17NO7S
and a molecular weight of 403.41 g/mol. Its IUPAC name is methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate |
| PubChem CID | 23612158 |
| Molecular Formula | C19H17NO7S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate |
| SMILES | COC(=O)C1=C(OC(=O)c2ccccc2OC)c2ccccc2S(=O)(=O)N1C |
| InChI | InChI=1S/C19H17NO7S/c1-20-16(19(22)26-3)17(13-9-5-7-11-15(13)28(20,23)24)27-18(21)12-8-4-6-10-14(12)25-2/h4-11H,1-3H3 |
| InChIKey | WSDKTNZYVUIWJO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate?
The IUPAC name of methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate (CID 23612158) is methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate.
What is the SMILES notation for methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate?
The canonical SMILES for methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate is COC(=O)C1=C(OC(=O)c2ccccc2OC)c2ccccc2S(=O)(=O)N1C.
What is the InChIKey of methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate?
The InChIKey is WSDKTNZYVUIWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO7S/c1-20-16(19(22)26-3)17(13-9-5-7-11-15(13)28(20,23)24)27-18(21)12-8-4-6-10-14(12)25-2/h4-11H,1-3H3.
What are the key properties of methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate?
methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate has a molecular weight of 403.41 g/mol, XLogP of 2.03, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-methoxybenzoyl)oxy-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxylate is sourced from PubChem (CID 23612158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).