About [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate
[5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate (PubChem CID 11841339) has the molecular formula C26H20O6
and a molecular weight of 428.44 g/mol. Its IUPAC name is [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate.
Molecular Properties
| Compound Name | [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate |
| PubChem CID | 11841339 |
| Molecular Formula | C26H20O6 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)Oc1cccc2c(OC(=O)c3ccccc3OC)cccc12 |
| InChI | InChI=1S/C26H20O6/c1-29-21-13-5-3-9-19(21)25(27)31-23-15-7-12-18-17(23)11-8-16-24(18)32-26(28)20-10-4-6-14-22(20)30-2/h3-16H,1-2H3 |
| InChIKey | GYWUWMCNOMYRLT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate?
The IUPAC name of [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate (CID 11841339) is [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate.
What is the SMILES notation for [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate?
The canonical SMILES for [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate is COc1ccccc1C(=O)Oc1cccc2c(OC(=O)c3ccccc3OC)cccc12.
What is the InChIKey of [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate?
The InChIKey is GYWUWMCNOMYRLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20O6/c1-29-21-13-5-3-9-19(21)25(27)31-23-15-7-12-18-17(23)11-8-16-24(18)32-26(28)20-10-4-6-14-22(20)30-2/h3-16H,1-2H3.
What are the key properties of [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate?
[5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate has a molecular weight of 428.44 g/mol, XLogP of 5.30, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-methoxybenzoyl)oxynaphthalen-1-yl] 2-methoxybenzoate is sourced from PubChem (CID 11841339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).