About ethane;methyl 2-methoxybenzoate
ethane;methyl 2-methoxybenzoate (PubChem CID 178037044) has the molecular formula C13H22O3
and a molecular weight of 226.32 g/mol. Its IUPAC name is ethane;methyl 2-methoxybenzoate.
Molecular Properties
| Compound Name | ethane;methyl 2-methoxybenzoate |
| PubChem CID | 178037044 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | ethane;methyl 2-methoxybenzoate |
| SMILES | CC.CC.COC(=O)c1ccccc1OC |
| InChI | InChI=1S/C9H10O3.2C2H6/c1-11-8-6-4-3-5-7(8)9(10)12-2;2*1-2/h3-6H,1-2H3;2*1-2H3 |
| InChIKey | XZXDWKDXISVYPY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methyl 2-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 2-methoxybenzoate?
The IUPAC name of ethane;methyl 2-methoxybenzoate (CID 178037044) is ethane;methyl 2-methoxybenzoate.
What is the SMILES notation for ethane;methyl 2-methoxybenzoate?
The canonical SMILES for ethane;methyl 2-methoxybenzoate is CC.CC.COC(=O)c1ccccc1OC.
What is the InChIKey of ethane;methyl 2-methoxybenzoate?
The InChIKey is XZXDWKDXISVYPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.2C2H6/c1-11-8-6-4-3-5-7(8)9(10)12-2;2*1-2/h3-6H,1-2H3;2*1-2H3.
What are the key properties of ethane;methyl 2-methoxybenzoate?
ethane;methyl 2-methoxybenzoate has a molecular weight of 226.32 g/mol, XLogP of 3.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 2-methoxybenzoate is sourced from PubChem (CID 178037044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).