C27H21NO7S — CID 2947692
(3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-acetyloxybenzoate (PubChem CID 2947692) has the molecular formula C27H21NO7S and a molecular weight of 503.53 g/mol. Its IUPAC name is (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-acetyloxybenzoate.
| Compound Name | (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-acetyloxybenzoate |
|---|---|
| PubChem CID | 2947692 |
| Molecular Formula | C27H21NO7S |
| Molecular Weight | 503.53 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | (3-benzoyl-1,1-dioxo-2-prop-2-enyl-1lambda6,2-benzothiazin-4-yl) 2-acetyloxybenzoate |
| SMILES | C=CCN1C(C(=O)c2ccccc2)=C(OC(=O)c2ccccc2OC(C)=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C27H21NO7S/c1-3-17-28-24(25(30)19-11-5-4-6-12-19)26(21-14-8-10-16-23(21)36(28,32)33)35-27(31)20-13-7-9-15-22(20)34-18(2)29/h3-16H,1,17H2,2H3 |
| InChIKey | PEJWRTPEFXEGPY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|