C24H16N2O5S — CID 2055421
[3-benzoyl-2-(cyanomethyl)-1,1-dioxo-1lambda6,2-benzothiazin-4-yl] benzoate (PubChem CID 2055421) has the molecular formula C24H16N2O5S and a molecular weight of 444.47 g/mol. Its IUPAC name is [3-benzoyl-2-(cyanomethyl)-1,1-dioxo-1lambda6,2-benzothiazin-4-yl] benzoate.
| Compound Name | [3-benzoyl-2-(cyanomethyl)-1,1-dioxo-1lambda6,2-benzothiazin-4-yl] benzoate |
|---|---|
| PubChem CID | 2055421 |
| Molecular Formula | C24H16N2O5S |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [3-benzoyl-2-(cyanomethyl)-1,1-dioxo-1lambda6,2-benzothiazin-4-yl] benzoate |
| SMILES | N#CCN1C(C(=O)c2ccccc2)=C(OC(=O)c2ccccc2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C24H16N2O5S/c25-15-16-26-21(22(27)17-9-3-1-4-10-17)23(31-24(28)18-11-5-2-6-12-18)19-13-7-8-14-20(19)32(26,29)30/h1-14H,16H2 |
| InChIKey | OVJAGUQCCDMYLM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|