C20H19NO5S — CID 23611990
(3-acetyl-1,1-dioxo-2-propyl-1λ6,2-benzothiazin-4-yl) benzoate (PubChem CID 23611990) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is (3-acetyl-1,1-dioxo-2-propyl-1λ6,2-benzothiazin-4-yl) benzoate.
| Compound Name | (3-acetyl-1,1-dioxo-2-propyl-1λ6,2-benzothiazin-4-yl) benzoate |
|---|---|
| PubChem CID | 23611990 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | (3-acetyl-1,1-dioxo-2-propyl-1λ6,2-benzothiazin-4-yl) benzoate |
| SMILES | CCCN1C(C(C)=O)=C(OC(=O)c2ccccc2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C20H19NO5S/c1-3-13-21-18(14(2)22)19(26-20(23)15-9-5-4-6-10-15)16-11-7-8-12-17(16)27(21,24)25/h4-12H,3,13H2,1-2H3 |
| InChIKey | GWSPQEFKUVFDEC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |