C20H16ClNO5S — CID 23612026
(3-acetyl-1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-chlorobenzoate (PubChem CID 23612026) has the molecular formula C20H16ClNO5S and a molecular weight of 417.87 g/mol. Its IUPAC name is (3-acetyl-1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-chlorobenzoate.
| Compound Name | (3-acetyl-1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-chlorobenzoate |
|---|---|
| PubChem CID | 23612026 |
| Molecular Formula | C20H16ClNO5S |
| Molecular Weight | 417.87 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | (3-acetyl-1,1-dioxo-2-prop-2-enyl-1λ6,2-benzothiazin-4-yl) 4-chlorobenzoate |
| SMILES | C=CCN1C(C(C)=O)=C(OC(=O)c2ccc(Cl)cc2)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C20H16ClNO5S/c1-3-12-22-18(13(2)23)19(16-6-4-5-7-17(16)28(22,25)26)27-20(24)14-8-10-15(21)11-9-14/h3-11H,1,12H2,2H3 |
| InChIKey | FYIRNCIIZGPWGN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.87 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|