C24H22N2O3S — CID 50814618
N-(2,6-dimethylphenyl)-5,5-dioxo-6-prop-2-enylbenzo[c][1,2]benzothiazine-9-carboxamide (PubChem CID 50814618) has the molecular formula C24H22N2O3S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-5,5-dioxo-6-prop-2-enylbenzo[c][1,2]benzothiazine-9-carboxamide.
| Compound Name | N-(2,6-dimethylphenyl)-5,5-dioxo-6-prop-2-enylbenzo[c][1,2]benzothiazine-9-carboxamide |
|---|---|
| PubChem CID | 50814618 |
| Molecular Formula | C24H22N2O3S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-(2,6-dimethylphenyl)-5,5-dioxo-6-prop-2-enylbenzo[c][1,2]benzothiazine-9-carboxamide |
| SMILES | C=CCN1c2ccc(C(=O)Nc3c(C)cccc3C)cc2-c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C24H22N2O3S/c1-4-14-26-21-13-12-18(24(27)25-23-16(2)8-7-9-17(23)3)15-20(21)19-10-5-6-11-22(19)30(26,28)29/h4-13,15H,1,14H2,2-3H3,(H,25,27) |
| InChIKey | LPCXUULUGYRSEZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|