C23H18N2O5S — CID 50814747
N-(1,3-benzodioxol-5-yl)-5,5-dioxo-6-prop-2-enylbenzo[c][1,2]benzothiazine-9-carboxamide (PubChem CID 50814747) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5,5-dioxo-6-prop-2-enylbenzo[c][1,2]benzothiazine-9-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5,5-dioxo-6-prop-2-enylbenzo[c][1,2]benzothiazine-9-carboxamide |
|---|---|
| PubChem CID | 50814747 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5,5-dioxo-6-prop-2-enylbenzo[c][1,2]benzothiazine-9-carboxamide |
| SMILES | C=CCN1c2ccc(C(=O)Nc3ccc4c(c3)OCO4)cc2-c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C23H18N2O5S/c1-2-11-25-19-9-7-15(12-18(19)17-5-3-4-6-22(17)31(25,27)28)23(26)24-16-8-10-20-21(13-16)30-14-29-20/h2-10,12-13H,1,11,14H2,(H,24,26) |
| InChIKey | UFBJEGAFTKVZDW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|