C20H19N3O5S — CID 18777752
N-(1,3-benzodioxol-5-yl)-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide (PubChem CID 18777752) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 18777752 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5,5-dioxo-8,9,10,11-tetrahydro-7H-azepino[2,1-c][1,2,4]benzothiadiazine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1ccc2c(c1)S(=O)(=O)N=C1CCCCCN12 |
| InChI | InChI=1S/C20H19N3O5S/c24-20(21-14-6-8-16-17(11-14)28-12-27-16)13-5-7-15-18(10-13)29(25,26)22-19-4-2-1-3-9-23(15)19/h5-8,10-11H,1-4,9,12H2,(H,21,24) |
| InChIKey | BDUGLZBPLFZERW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |