C18H15N3O4S — CID 54682994
2-(cyanomethyl)-4-hydroxy-N-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 54682994) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-(cyanomethyl)-4-hydroxy-N-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | 2-(cyanomethyl)-4-hydroxy-N-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 54682994 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 2-(cyanomethyl)-4-hydroxy-N-methyl-1,1-dioxo-N-phenyl-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CN(C(=O)C1=C(O)c2ccccc2S(=O)(=O)N1CC#N)c1ccccc1 |
| InChI | InChI=1S/C18H15N3O4S/c1-20(13-7-3-2-4-8-13)18(23)16-17(22)14-9-5-6-10-15(14)26(24,25)21(16)12-11-19/h2-10,22H,12H2,1H3 |
| InChIKey | SUAMGXWYEOZINY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|