C24H20N2O5S — CID 54728120
N-benzyl-4-hydroxy-1,1-dioxo-2-phenacyl-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 54728120) has the molecular formula C24H20N2O5S and a molecular weight of 448.50 g/mol. Its IUPAC name is N-benzyl-4-hydroxy-1,1-dioxo-2-phenacyl-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | N-benzyl-4-hydroxy-1,1-dioxo-2-phenacyl-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 54728120 |
| Molecular Formula | C24H20N2O5S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-benzyl-4-hydroxy-1,1-dioxo-2-phenacyl-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1=C(O)c2ccccc2S(=O)(=O)N1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H20N2O5S/c27-20(18-11-5-2-6-12-18)16-26-22(24(29)25-15-17-9-3-1-4-10-17)23(28)19-13-7-8-14-21(19)32(26,30)31/h1-14,28H,15-16H2,(H,25,29) |
| InChIKey | GEQVOFINTZUONR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |