C25H19NO7S — CID 75180017
methyl 4-[2-[3-[hydroxy(phenyl)methylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]acetyl]benzoate (PubChem CID 75180017) has the molecular formula C25H19NO7S and a molecular weight of 477.49 g/mol. Its IUPAC name is methyl 4-[2-[3-[hydroxy(phenyl)methylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]acetyl]benzoate.
| Compound Name | methyl 4-[2-[3-[hydroxy(phenyl)methylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]acetyl]benzoate |
|---|---|
| PubChem CID | 75180017 |
| Molecular Formula | C25H19NO7S |
| Molecular Weight | 477.49 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | methyl 4-[2-[3-[hydroxy(phenyl)methylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]acetyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)CN2C(=C(O)c3ccccc3)C(=O)c3ccccc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C25H19NO7S/c1-33-25(30)18-13-11-16(12-14-18)20(27)15-26-22(23(28)17-7-3-2-4-8-17)24(29)19-9-5-6-10-21(19)34(26,31)32/h2-14,28H,15H2,1H3 |
| InChIKey | AASGHIKVNJSKQO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|