C23H17ClN2O5S — CID 50993326
N-(2-chlorophenyl)-2-[(3E)-3-[hydroxy(phenyl)methylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]acetamide (PubChem CID 50993326) has the molecular formula C23H17ClN2O5S and a molecular weight of 468.92 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[(3E)-3-[hydroxy(phenyl)methylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[(3E)-3-[hydroxy(phenyl)methylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]acetamide |
|---|---|
| PubChem CID | 50993326 |
| Molecular Formula | C23H17ClN2O5S |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | N-(2-chlorophenyl)-2-[(3E)-3-[hydroxy(phenyl)methylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]acetamide |
| SMILES | O=C(CN1/C(=C(/O)c2ccccc2)C(=O)c2ccccc2S1(=O)=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C23H17ClN2O5S/c24-17-11-5-6-12-18(17)25-20(27)14-26-21(22(28)15-8-2-1-3-9-15)23(29)16-10-4-7-13-19(16)32(26,30)31/h1-13,28H,14H2,(H,25,27)/b22-21+ |
| InChIKey | SMVYZGYAQSRFFN-QURGRASLSA-N |
| XLogP | 4.09 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|