C25H16F3N3O6S — CID 162658665
2-[(3E)-3-[(4-cyanophenyl)-hydroxymethylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]-N-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 162658665) has the molecular formula C25H16F3N3O6S and a molecular weight of 543.48 g/mol. Its IUPAC name is 2-[(3E)-3-[(4-cyanophenyl)-hydroxymethylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]-N-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(3E)-3-[(4-cyanophenyl)-hydroxymethylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]-N-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 162658665 |
| Molecular Formula | C25H16F3N3O6S |
| Molecular Weight | 543.48 g/mol |
| Exact Mass | 543.07 |
| IUPAC Name | 2-[(3E)-3-[(4-cyanophenyl)-hydroxymethylidene]-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]-N-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | N#Cc1ccc(/C(O)=C2/C(=O)c3ccccc3S(=O)(=O)N2CC(=O)Nc2cccc(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H16F3N3O6S/c26-25(27,28)37-18-5-3-4-17(12-18)30-21(32)14-31-22(23(33)16-10-8-15(13-29)9-11-16)24(34)19-6-1-2-7-20(19)38(31,35)36/h1-12,33H,14H2,(H,30,32)/b23-22+ |
| InChIKey | NXLSAUSEVXYINR-GHVJWSGMSA-N |
| XLogP | 4.21 |
| TPSA | 136.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|