C24H14ClF5N2O6S — CID 162646301
2-[(3E)-3-[(3-chloro-4-fluorophenyl)-hydroxymethylidene]-7-fluoro-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]-N-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 162646301) has the molecular formula C24H14ClF5N2O6S and a molecular weight of 588.89 g/mol. Its IUPAC name is 2-[(3E)-3-[(3-chloro-4-fluorophenyl)-hydroxymethylidene]-7-fluoro-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]-N-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-[(3E)-3-[(3-chloro-4-fluorophenyl)-hydroxymethylidene]-7-fluoro-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]-N-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 162646301 |
| Molecular Formula | C24H14ClF5N2O6S |
| Molecular Weight | 588.89 g/mol |
| Exact Mass | 588.02 |
| IUPAC Name | 2-[(3E)-3-[(3-chloro-4-fluorophenyl)-hydroxymethylidene]-7-fluoro-1,1,4-trioxo-1λ6,2-benzothiazin-2-yl]-N-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CN1/C(=C(/O)c2ccc(F)c(Cl)c2)C(=O)c2ccc(F)cc2S1(=O)=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C24H14ClF5N2O6S/c25-17-8-12(4-7-18(17)27)22(34)21-23(35)16-6-5-13(26)9-19(16)39(36,37)32(21)11-20(33)31-14-2-1-3-15(10-14)38-24(28,29)30/h1-10,34H,11H2,(H,31,33)/b22-21+ |
| InChIKey | NBQXJQPYXJPNHD-QURGRASLSA-N |
| XLogP | 5.27 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.89 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|