C20H14FNO4S — CID 46871944
(3E)-7-fluoro-3-[hydroxy(naphthalen-2-yl)methylidene]-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-4-one (PubChem CID 46871944) has the molecular formula C20H14FNO4S and a molecular weight of 383.40 g/mol. Its IUPAC name is (3E)-7-fluoro-3-[hydroxy(naphthalen-2-yl)methylidene]-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-4-one.
| Compound Name | (3E)-7-fluoro-3-[hydroxy(naphthalen-2-yl)methylidene]-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 46871944 |
| Molecular Formula | C20H14FNO4S |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (3E)-7-fluoro-3-[hydroxy(naphthalen-2-yl)methylidene]-2-methyl-1,1-dioxo-1λ6,2-benzothiazin-4-one |
| SMILES | CN1/C(=C(/O)c2ccc3ccccc3c2)C(=O)c2ccc(F)cc2S1(=O)=O |
| InChI | InChI=1S/C20H14FNO4S/c1-22-18(19(23)14-7-6-12-4-2-3-5-13(12)10-14)20(24)16-9-8-15(21)11-17(16)27(22,25)26/h2-11,23H,1H3/b19-18+ |
| InChIKey | XAQDTUOPIBDKHZ-VHEBQXMUSA-N |
| XLogP | 3.72 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|