C24H23NO4S — CID 91316808
7-tert-butyl-2-methyl-3-(naphthalene-2-carbonyl)-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one (PubChem CID 91316808) has the molecular formula C24H23NO4S and a molecular weight of 421.52 g/mol. Its IUPAC name is 7-tert-butyl-2-methyl-3-(naphthalene-2-carbonyl)-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one.
| Compound Name | 7-tert-butyl-2-methyl-3-(naphthalene-2-carbonyl)-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 91316808 |
| Molecular Formula | C24H23NO4S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 7-tert-butyl-2-methyl-3-(naphthalene-2-carbonyl)-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one |
| SMILES | CN1C(C(=O)c2ccc3ccccc3c2)C(=O)c2ccc(C(C)(C)C)cc2S1(=O)=O |
| InChI | InChI=1S/C24H23NO4S/c1-24(2,3)18-11-12-19-20(14-18)30(28,29)25(4)21(23(19)27)22(26)17-10-9-15-7-5-6-8-16(15)13-17/h5-14,21H,1-4H3 |
| InChIKey | VDAKDKKPZIDVPH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|