C17H12N2O4S — CID 90866964
3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzonitrile (PubChem CID 90866964) has the molecular formula C17H12N2O4S and a molecular weight of 340.36 g/mol. Its IUPAC name is 3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzonitrile.
| Compound Name | 3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzonitrile |
|---|---|
| PubChem CID | 90866964 |
| Molecular Formula | C17H12N2O4S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 3-(2-methyl-1,1,4-trioxo-3H-1λ6,2-benzothiazine-3-carbonyl)benzonitrile |
| SMILES | CN1C(C(=O)c2cccc(C#N)c2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C17H12N2O4S/c1-19-15(16(20)12-6-4-5-11(9-12)10-18)17(21)13-7-2-3-8-14(13)24(19,22)23/h2-9,15H,1H3 |
| InChIKey | WKTHYQSNNPEGLR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 95.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|