C17H13Cl2NO4S — CID 123512616
3-(3,4-dichlorobenzoyl)-2-ethyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one (PubChem CID 123512616) has the molecular formula C17H13Cl2NO4S and a molecular weight of 398.27 g/mol. Its IUPAC name is 3-(3,4-dichlorobenzoyl)-2-ethyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one.
| Compound Name | 3-(3,4-dichlorobenzoyl)-2-ethyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one |
|---|---|
| PubChem CID | 123512616 |
| Molecular Formula | C17H13Cl2NO4S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 3-(3,4-dichlorobenzoyl)-2-ethyl-1,1-dioxo-3H-1λ6,2-benzothiazin-4-one |
| SMILES | CCN1C(C(=O)c2ccc(Cl)c(Cl)c2)C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C17H13Cl2NO4S/c1-2-20-15(16(21)10-7-8-12(18)13(19)9-10)17(22)11-5-3-4-6-14(11)25(20,23)24/h3-9,15H,2H2,1H3 |
| InChIKey | REJPEQJWXURMLP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|