C12H12Cl2O — CID 126593158
(3,4-dichlorophenyl)-[(2S)-2,3-dimethylcyclopropyl]methanone (PubChem CID 126593158) has the molecular formula C12H12Cl2O and a molecular weight of 243.13 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[(2S)-2,3-dimethylcyclopropyl]methanone.
| Compound Name | (3,4-dichlorophenyl)-[(2S)-2,3-dimethylcyclopropyl]methanone |
|---|---|
| PubChem CID | 126593158 |
| Molecular Formula | C12H12Cl2O |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | (3,4-dichlorophenyl)-[(2S)-2,3-dimethylcyclopropyl]methanone |
| SMILES | CC1C(C(=O)c2ccc(Cl)c(Cl)c2)[C@H]1C |
| InChI | InChI=1S/C12H12Cl2O/c1-6-7(2)11(6)12(15)8-3-4-9(13)10(14)5-8/h3-7,11H,1-2H3/t6-,7?,11?/m0/s1 |
| InChIKey | YNIUIUGRFJDJEZ-XOQGZYLQSA-N |
| XLogP | 4.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |