C13H15Cl2NO2 — CID 110292311
(3,4-dichlorophenyl)-(3,5-dimethylmorpholin-4-yl)methanone (PubChem CID 110292311) has the molecular formula C13H15Cl2NO2 and a molecular weight of 288.17 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(3,5-dimethylmorpholin-4-yl)methanone.
| Compound Name | (3,4-dichlorophenyl)-(3,5-dimethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 110292311 |
| Molecular Formula | C13H15Cl2NO2 |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (3,4-dichlorophenyl)-(3,5-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1COCC(C)N1C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NO2/c1-8-6-18-7-9(2)16(8)13(17)10-3-4-11(14)12(15)5-10/h3-5,8-9H,6-7H2,1-2H3 |
| InChIKey | FNAYYXXIELXTHG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |