C9H6Cl2O2 — CID 116826504
(3,4-dichlorophenyl)-(oxiran-2-yl)methanone (PubChem CID 116826504) has the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(oxiran-2-yl)methanone.
| Compound Name | (3,4-dichlorophenyl)-(oxiran-2-yl)methanone |
|---|---|
| PubChem CID | 116826504 |
| Molecular Formula | C9H6Cl2O2 |
| Molecular Weight | 217.05 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | (3,4-dichlorophenyl)-(oxiran-2-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)C1CO1 |
| InChI | InChI=1S/C9H6Cl2O2/c10-6-2-1-5(3-7(6)11)9(12)8-4-13-8/h1-3,8H,4H2 |
| InChIKey | GBEHAOOTOXGYDX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.05 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|