C10H9Cl2NO2 — CID 97180754
3,4-dichloro-N-[[(2S)-oxiran-2-yl]methyl]benzamide (PubChem CID 97180754) has the molecular formula C10H9Cl2NO2 and a molecular weight of 246.09 g/mol. Its IUPAC name is 3,4-dichloro-N-[[(2S)-oxiran-2-yl]methyl]benzamide.
| Compound Name | 3,4-dichloro-N-[[(2S)-oxiran-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 97180754 |
| Molecular Formula | C10H9Cl2NO2 |
| Molecular Weight | 246.09 g/mol |
| Exact Mass | 245.00 |
| IUPAC Name | 3,4-dichloro-N-[[(2S)-oxiran-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@H]1CO1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H9Cl2NO2/c11-8-2-1-6(3-9(8)12)10(14)13-4-7-5-15-7/h1-3,7H,4-5H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | FTQFTWQXQLTUQR-ZETCQYMHSA-N |
| XLogP | 2.12 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.09 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|