C14H17Cl2NO2 — CID 106122138
3,4-dichloro-N-[(4-hydroxycyclohexyl)methyl]benzamide (PubChem CID 106122138) has the molecular formula C14H17Cl2NO2 and a molecular weight of 302.20 g/mol. Its IUPAC name is 3,4-dichloro-N-[(4-hydroxycyclohexyl)methyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(4-hydroxycyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 106122138 |
| Molecular Formula | C14H17Cl2NO2 |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 3,4-dichloro-N-[(4-hydroxycyclohexyl)methyl]benzamide |
| SMILES | O=C(NCC1CCC(O)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO2/c15-12-6-3-10(7-13(12)16)14(19)17-8-9-1-4-11(18)5-2-9/h3,6-7,9,11,18H,1-2,4-5,8H2,(H,17,19) |
| InChIKey | ZGVQGKPGVJEYHK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |