C13H14BrCl2NO — CID 114147272
N-[(3-bromocyclopentyl)methyl]-3,4-dichlorobenzamide (PubChem CID 114147272) has the molecular formula C13H14BrCl2NO and a molecular weight of 351.07 g/mol. Its IUPAC name is N-[(3-bromocyclopentyl)methyl]-3,4-dichlorobenzamide.
| Compound Name | N-[(3-bromocyclopentyl)methyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 114147272 |
| Molecular Formula | C13H14BrCl2NO |
| Molecular Weight | 351.07 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | N-[(3-bromocyclopentyl)methyl]-3,4-dichlorobenzamide |
| SMILES | O=C(NCC1CCC(Br)C1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H14BrCl2NO/c14-10-3-1-8(5-10)7-17-13(18)9-2-4-11(15)12(16)6-9/h2,4,6,8,10H,1,3,5,7H2,(H,17,18) |
| InChIKey | MCSIZSLCCSNVFQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.07 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|