C15H20BrNO — CID 114147220
N-[(3-bromocyclopentyl)methyl]-3,4-dimethylbenzamide (PubChem CID 114147220) has the molecular formula C15H20BrNO and a molecular weight of 310.24 g/mol. Its IUPAC name is N-[(3-bromocyclopentyl)methyl]-3,4-dimethylbenzamide.
| Compound Name | N-[(3-bromocyclopentyl)methyl]-3,4-dimethylbenzamide |
|---|---|
| PubChem CID | 114147220 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-[(3-bromocyclopentyl)methyl]-3,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)NCC2CCC(Br)C2)cc1C |
| InChI | InChI=1S/C15H20BrNO/c1-10-3-5-13(7-11(10)2)15(18)17-9-12-4-6-14(16)8-12/h3,5,7,12,14H,4,6,8-9H2,1-2H3,(H,17,18) |
| InChIKey | OKAIFOXYACVONV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|