C14H17BrN2O4 — CID 106128710
N-[(3-bromocyclopentyl)methyl]-3-methoxy-4-nitrobenzamide (PubChem CID 106128710) has the molecular formula C14H17BrN2O4 and a molecular weight of 357.20 g/mol. Its IUPAC name is N-[(3-bromocyclopentyl)methyl]-3-methoxy-4-nitrobenzamide.
| Compound Name | N-[(3-bromocyclopentyl)methyl]-3-methoxy-4-nitrobenzamide |
|---|---|
| PubChem CID | 106128710 |
| Molecular Formula | C14H17BrN2O4 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | N-[(3-bromocyclopentyl)methyl]-3-methoxy-4-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCC2CCC(Br)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17BrN2O4/c1-21-13-7-10(3-5-12(13)17(19)20)14(18)16-8-9-2-4-11(15)6-9/h3,5,7,9,11H,2,4,6,8H2,1H3,(H,16,18) |
| InChIKey | GSRWQYLNTOFZPC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|