C14H16BrClINO — CID 114147750
N-[(3-bromocyclohexyl)methyl]-3-chloro-4-iodobenzamide (PubChem CID 114147750) has the molecular formula C14H16BrClINO and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[(3-bromocyclohexyl)methyl]-3-chloro-4-iodobenzamide.
| Compound Name | N-[(3-bromocyclohexyl)methyl]-3-chloro-4-iodobenzamide |
|---|---|
| PubChem CID | 114147750 |
| Molecular Formula | C14H16BrClINO |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 454.91 |
| IUPAC Name | N-[(3-bromocyclohexyl)methyl]-3-chloro-4-iodobenzamide |
| SMILES | O=C(NCC1CCCC(Br)C1)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C14H16BrClINO/c15-11-3-1-2-9(6-11)8-18-14(19)10-4-5-13(17)12(16)7-10/h4-5,7,9,11H,1-3,6,8H2,(H,18,19) |
| InChIKey | RXZUMUXJPKHNLW-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|