C14H17ClINO2 — CID 103736731
3-chloro-N-[(2-hydroxycyclohexyl)methyl]-4-iodobenzamide (PubChem CID 103736731) has the molecular formula C14H17ClINO2 and a molecular weight of 393.65 g/mol. Its IUPAC name is 3-chloro-N-[(2-hydroxycyclohexyl)methyl]-4-iodobenzamide.
| Compound Name | 3-chloro-N-[(2-hydroxycyclohexyl)methyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 103736731 |
| Molecular Formula | C14H17ClINO2 |
| Molecular Weight | 393.65 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | 3-chloro-N-[(2-hydroxycyclohexyl)methyl]-4-iodobenzamide |
| SMILES | O=C(NCC1CCCCC1O)c1ccc(I)c(Cl)c1 |
| InChI | InChI=1S/C14H17ClINO2/c15-11-7-9(5-6-12(11)16)14(19)17-8-10-3-1-2-4-13(10)18/h5-7,10,13,18H,1-4,8H2,(H,17,19) |
| InChIKey | JPUGFVBHJBFFFU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.65 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|