C14H18ClNO2S — CID 107031032
2-chloro-N-[(2-hydroxycyclohexyl)methyl]-5-sulfanylbenzamide (PubChem CID 107031032) has the molecular formula C14H18ClNO2S and a molecular weight of 299.82 g/mol. Its IUPAC name is 2-chloro-N-[(2-hydroxycyclohexyl)methyl]-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N-[(2-hydroxycyclohexyl)methyl]-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107031032 |
| Molecular Formula | C14H18ClNO2S |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-chloro-N-[(2-hydroxycyclohexyl)methyl]-5-sulfanylbenzamide |
| SMILES | O=C(NCC1CCCCC1O)c1cc(S)ccc1Cl |
| InChI | InChI=1S/C14H18ClNO2S/c15-12-6-5-10(19)7-11(12)14(18)16-8-9-3-1-2-4-13(9)17/h5-7,9,13,17,19H,1-4,8H2,(H,16,18) |
| InChIKey | JASJJMAFGXOJFR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|