C13H16ClNO2S — CID 114179839
2-chloro-N-[2-(hydroxymethyl)cyclopentyl]-5-sulfanylbenzamide (PubChem CID 114179839) has the molecular formula C13H16ClNO2S and a molecular weight of 285.80 g/mol. Its IUPAC name is 2-chloro-N-[2-(hydroxymethyl)cyclopentyl]-5-sulfanylbenzamide.
| Compound Name | 2-chloro-N-[2-(hydroxymethyl)cyclopentyl]-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 114179839 |
| Molecular Formula | C13H16ClNO2S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 2-chloro-N-[2-(hydroxymethyl)cyclopentyl]-5-sulfanylbenzamide |
| SMILES | O=C(NC1CCCC1CO)c1cc(S)ccc1Cl |
| InChI | InChI=1S/C13H16ClNO2S/c14-11-5-4-9(18)6-10(11)13(17)15-12-3-1-2-8(12)7-16/h4-6,8,12,16,18H,1-3,7H2,(H,15,17) |
| InChIKey | KYXGYAWPXCXZML-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|