C13H16ClNO3 — CID 113339750
3-chloro-4-hydroxy-N-[2-(hydroxymethyl)cyclopentyl]benzamide (PubChem CID 113339750) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[2-(hydroxymethyl)cyclopentyl]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[2-(hydroxymethyl)cyclopentyl]benzamide |
|---|---|
| PubChem CID | 113339750 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[2-(hydroxymethyl)cyclopentyl]benzamide |
| SMILES | O=C(NC1CCCC1CO)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C13H16ClNO3/c14-10-6-8(4-5-12(10)17)13(18)15-11-3-1-2-9(11)7-16/h4-6,9,11,16-17H,1-3,7H2,(H,15,18) |
| InChIKey | RKINWYWWMITLTM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |