C12H15NO5 — CID 113358419
N-(1,4-dioxan-2-ylmethyl)-3,4-dihydroxybenzamide (PubChem CID 113358419) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-3,4-dihydroxybenzamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-3,4-dihydroxybenzamide |
|---|---|
| PubChem CID | 113358419 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-3,4-dihydroxybenzamide |
| SMILES | O=C(NCC1COCCO1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C12H15NO5/c14-10-2-1-8(5-11(10)15)12(16)13-6-9-7-17-3-4-18-9/h1-2,5,9,14-15H,3-4,6-7H2,(H,13,16) |
| InChIKey | ZXHZOCYGDXRPIM-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|