C12H15NO3S — CID 107023717
N-(1,4-dioxan-2-ylmethyl)-3-sulfanylbenzamide (PubChem CID 107023717) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-3-sulfanylbenzamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-3-sulfanylbenzamide |
|---|---|
| PubChem CID | 107023717 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-3-sulfanylbenzamide |
| SMILES | O=C(NCC1COCCO1)c1cccc(S)c1 |
| InChI | InChI=1S/C12H15NO3S/c14-12(9-2-1-3-11(17)6-9)13-7-10-8-15-4-5-16-10/h1-3,6,10,17H,4-5,7-8H2,(H,13,14) |
| InChIKey | VRJZJNZMBJUUSL-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|