C17H20N2O6S — CID 97193975
N-[[(2S)-1,4-dioxan-2-yl]methyl]-3-(furan-3-ylmethylsulfamoyl)benzamide (PubChem CID 97193975) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is N-[[(2S)-1,4-dioxan-2-yl]methyl]-3-(furan-3-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[[(2S)-1,4-dioxan-2-yl]methyl]-3-(furan-3-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 97193975 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-[[(2S)-1,4-dioxan-2-yl]methyl]-3-(furan-3-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(NC[C@H]1COCCO1)c1cccc(S(=O)(=O)NCc2ccoc2)c1 |
| InChI | InChI=1S/C17H20N2O6S/c20-17(18-10-15-12-24-6-7-25-15)14-2-1-3-16(8-14)26(21,22)19-9-13-4-5-23-11-13/h1-5,8,11,15,19H,6-7,9-10,12H2,(H,18,20)/t15-/m0/s1 |
| InChIKey | ZTOZFWMURPJBDE-HNNXBMFYSA-N |
| XLogP | 0.90 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |