C16H20N4O5S — CID 72881405
N-(1,4-dioxan-2-ylmethyl)-3-(1H-pyrazol-5-ylmethylsulfamoyl)benzamide (PubChem CID 72881405) has the molecular formula C16H20N4O5S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-3-(1H-pyrazol-5-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-3-(1H-pyrazol-5-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 72881405 |
| Molecular Formula | C16H20N4O5S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-3-(1H-pyrazol-5-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(NCC1COCCO1)c1cccc(S(=O)(=O)NCc2ccn[nH]2)c1 |
| InChI | InChI=1S/C16H20N4O5S/c21-16(17-10-14-11-24-6-7-25-14)12-2-1-3-15(8-12)26(22,23)19-9-13-4-5-18-20-13/h1-5,8,14,19H,6-7,9-11H2,(H,17,21)(H,18,20) |
| InChIKey | ZVAAODLLTPCRLI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |