C15H15N5O4S — CID 77089657
N-(1,2-oxazol-3-ylmethyl)-3-(1H-pyrazol-5-ylmethylsulfamoyl)benzamide (PubChem CID 77089657) has the molecular formula C15H15N5O4S and a molecular weight of 361.38 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)-3-(1H-pyrazol-5-ylmethylsulfamoyl)benzamide.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)-3-(1H-pyrazol-5-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 77089657 |
| Molecular Formula | C15H15N5O4S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)-3-(1H-pyrazol-5-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(NCc1ccon1)c1cccc(S(=O)(=O)NCc2ccn[nH]2)c1 |
| InChI | InChI=1S/C15H15N5O4S/c21-15(16-9-13-5-7-24-20-13)11-2-1-3-14(8-11)25(22,23)18-10-12-4-6-17-19-12/h1-8,18H,9-10H2,(H,16,21)(H,17,19) |
| InChIKey | DYXCNYZFFNTLGK-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |