3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid

C15H17NO5 — CID 76907237

IUPAC3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid
SMILESO=C(O)C=Cc1cccc(C(=O)NCC2COCCO2)c1
InChIInChI=1S/C15H17NO5/c17-14(18)5-4-11-2-1-3-12(8-11)15(19)16-9-13-10-20-6-7-21-13/h1-5,8,13H,6-7,9-10H2,(H,16,19)(H,17,18)
InChIKeyRBDBCARRTDWVLF-UHFFFAOYSA-N
MW291.30 g/mol
LogP0.93
Rot. Bonds5

About 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid

3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid (PubChem CID 76907237) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid.

Molecular Properties

Compound Name3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid
PubChem CID76907237
Molecular FormulaC15H17NO5
Molecular Weight291.30 g/mol
Exact Mass291.11
IUPAC Name3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid
SMILESO=C(O)C=Cc1cccc(C(=O)NCC2COCCO2)c1
InChIInChI=1S/C15H17NO5/c17-14(18)5-4-11-2-1-3-12(8-11)15(19)16-9-13-10-20-6-7-21-13/h1-5,8,13H,6-7,9-10H2,(H,16,19)(H,17,18)
InChIKeyRBDBCARRTDWVLF-UHFFFAOYSA-N
XLogP0.93
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.30
LogP ≤ 50.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid?
The IUPAC name of 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid (CID 76907237) is 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid.
What is the SMILES notation for 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid?
The canonical SMILES for 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid is O=C(O)C=Cc1cccc(C(=O)NCC2COCCO2)c1.
What is the InChIKey of 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid?
The InChIKey is RBDBCARRTDWVLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO5/c17-14(18)5-4-11-2-1-3-12(8-11)15(19)16-9-13-10-20-6-7-21-13/h1-5,8,13H,6-7,9-10H2,(H,16,19)(H,17,18).
What are the key properties of 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid?
3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid has a molecular weight of 291.30 g/mol, XLogP of 0.93, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid is sourced from PubChem (CID 76907237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).