C15H17NO5 — CID 76907237
3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid (PubChem CID 76907237) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76907237 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 3-[3-(1,4-dioxan-2-ylmethylcarbamoyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(C(=O)NCC2COCCO2)c1 |
| InChI | InChI=1S/C15H17NO5/c17-14(18)5-4-11-2-1-3-12(8-11)15(19)16-9-13-10-20-6-7-21-13/h1-5,8,13H,6-7,9-10H2,(H,16,19)(H,17,18) |
| InChIKey | RBDBCARRTDWVLF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|