C14H16N2O5 — CID 76978753
3-[6-(1,4-dioxan-2-ylmethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 76978753) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 3-[6-(1,4-dioxan-2-ylmethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 3-[6-(1,4-dioxan-2-ylmethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76978753 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-[6-(1,4-dioxan-2-ylmethylcarbamoyl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(C(=O)NCC2COCCO2)nc1 |
| InChI | InChI=1S/C14H16N2O5/c17-13(18)4-2-10-1-3-12(15-7-10)14(19)16-8-11-9-20-5-6-21-11/h1-4,7,11H,5-6,8-9H2,(H,16,19)(H,17,18) |
| InChIKey | ITLAVZHWCBDZTD-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|