C8H12N4O3 — CID 97054054
N-[[(2R)-1,4-dioxan-2-yl]methyl]-2H-triazole-4-carboxamide (PubChem CID 97054054) has the molecular formula C8H12N4O3 and a molecular weight of 212.21 g/mol. Its IUPAC name is N-[[(2R)-1,4-dioxan-2-yl]methyl]-2H-triazole-4-carboxamide.
| Compound Name | N-[[(2R)-1,4-dioxan-2-yl]methyl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 97054054 |
| Molecular Formula | C8H12N4O3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | N-[[(2R)-1,4-dioxan-2-yl]methyl]-2H-triazole-4-carboxamide |
| SMILES | O=C(NC[C@@H]1COCCO1)c1cn[nH]n1 |
| InChI | InChI=1S/C8H12N4O3/c13-8(7-4-10-12-11-7)9-3-6-5-14-1-2-15-6/h4,6H,1-3,5H2,(H,9,13)(H,10,11,12)/t6-/m1/s1 |
| InChIKey | ZEPXQAAAVKQYHQ-ZCFIWIBFSA-N |
| XLogP | -1.05 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |