C12H18N4O3 — CID 107374710
N-(1,4-dioxan-2-ylmethyl)-5-(ethylamino)pyrazine-2-carboxamide (PubChem CID 107374710) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-5-(ethylamino)pyrazine-2-carboxamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-5-(ethylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107374710 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-5-(ethylamino)pyrazine-2-carboxamide |
| SMILES | CCNc1cnc(C(=O)NCC2COCCO2)cn1 |
| InChI | InChI=1S/C12H18N4O3/c1-2-13-11-7-14-10(6-15-11)12(17)16-5-9-8-18-3-4-19-9/h6-7,9H,2-5,8H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | XJQSDFSZUQFYRH-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |