C14H21N3O3 — CID 62180963
N-(1,4-dioxan-2-ylmethyl)-4-(propylamino)pyridine-2-carboxamide (PubChem CID 62180963) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-4-(propylamino)pyridine-2-carboxamide.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-4-(propylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 62180963 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-4-(propylamino)pyridine-2-carboxamide |
| SMILES | CCCNc1ccnc(C(=O)NCC2COCCO2)c1 |
| InChI | InChI=1S/C14H21N3O3/c1-2-4-15-11-3-5-16-13(8-11)14(18)17-9-12-10-19-6-7-20-12/h3,5,8,12H,2,4,6-7,9-10H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | LZLSIMRMQUCZGP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |