C12H20N4O2 — CID 80797541
4-N-(1,4-dioxan-2-ylmethyl)-2-N-propylpyrimidine-2,4-diamine (PubChem CID 80797541) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 4-N-(1,4-dioxan-2-ylmethyl)-2-N-propylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(1,4-dioxan-2-ylmethyl)-2-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80797541 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 4-N-(1,4-dioxan-2-ylmethyl)-2-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1nccc(NCC2COCCO2)n1 |
| InChI | InChI=1S/C12H20N4O2/c1-2-4-13-12-14-5-3-11(16-12)15-8-10-9-17-6-7-18-10/h3,5,10H,2,4,6-9H2,1H3,(H2,13,14,15,16) |
| InChIKey | YDQYUPJJYYJMOA-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |